alethz9uLadyannouse alethz9uLadyannouse

02-03-2017
Biology

contestada

The science of population size, distribution, and composition is defined as:

Respuesta :

JonHenderson55 JonHenderson55

02-03-2017

The answer is: "demography" .
__________________________________________________________

Answer Link

Otras preguntas

El fraile saco el alacran de la tel y ya no era... A) un alacran B) grande C) una joya.

The width of a red blood cell is approximately 8 micrometers, which is 8 x 10^-6 meters. Give your answer in scientific notation.

If f(x)=-2x+8 determine the value of y for each x value 7,8,9

PLEASE ANSWER ASAP!! IREADY QUESTION How has m ing the quilting group changed Jada's thoughts about her friends? A)Jada understands that being away from her fri

cosec(6b+pi/8)=sec(2b-pi/8)

The combustion of ethanol, C2H5OH(l), in oxygen to form carbon dioxide gas and water vapor is shown by which balanced chemical equation?

Beowulf: epic :: Le Morte d'Arthur: A) fable B) drama C) frame story D) legend

What is the point-slope form of a line that has a slope of 5 and passes through the point (3,-4)? Show your work.

How could you calculate 65% of a number explain

find the x intercept and y intercept of the graph of the equation. 5x+4y=20